C17H11FN2O3 — CID 7560760
N-(2-cyano-1-benzofuran-3-yl)-2-(2-fluorophenoxy)acetamide (PubChem CID 7560760) has the molecular formula C17H11FN2O3 and a molecular weight of 310.28 g/mol. Its IUPAC name is N-(2-cyano-1-benzofuran-3-yl)-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-(2-cyano-1-benzofuran-3-yl)-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 7560760 |
| Molecular Formula | C17H11FN2O3 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(2-cyano-1-benzofuran-3-yl)-2-(2-fluorophenoxy)acetamide |
| SMILES | N#Cc1oc2ccccc2c1NC(=O)COc1ccccc1F |
| InChI | InChI=1S/C17H11FN2O3/c18-12-6-2-4-8-14(12)22-10-16(21)20-17-11-5-1-3-7-13(11)23-15(17)9-19/h1-8H,10H2,(H,20,21) |
| InChIKey | QGDACPPDUCBWTR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |