C13H12N2O2 — CID 176860593
N-(2-cyano-1-benzofuran-3-yl)-2-methylpropanamide (PubChem CID 176860593) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(2-cyano-1-benzofuran-3-yl)-2-methylpropanamide.
| Compound Name | N-(2-cyano-1-benzofuran-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 176860593 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-(2-cyano-1-benzofuran-3-yl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1c(C#N)oc2ccccc12 |
| InChI | InChI=1S/C13H12N2O2/c1-8(2)13(16)15-12-9-5-3-4-6-10(9)17-11(12)7-14/h3-6,8H,1-2H3,(H,15,16) |
| InChIKey | VNBVKYVWIJPHBF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |