C14H10N2O5 — CID 69068149
3-[[(E)-2-cyano-3-hydroxybut-2-enoyl]amino]-1-benzofuran-2-carboxylic acid (PubChem CID 69068149) has the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. Its IUPAC name is 3-[[(E)-2-cyano-3-hydroxybut-2-enoyl]amino]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[[(E)-2-cyano-3-hydroxybut-2-enoyl]amino]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 69068149 |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-[[(E)-2-cyano-3-hydroxybut-2-enoyl]amino]-1-benzofuran-2-carboxylic acid |
| SMILES | C/C(O)=C(/C#N)C(=O)Nc1c(C(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C14H10N2O5/c1-7(17)9(6-15)13(18)16-11-8-4-2-3-5-10(8)21-12(11)14(19)20/h2-5,17H,1H3,(H,16,18)(H,19,20)/b9-7+ |
| InChIKey | AGVICLVGOKABSO-VQHVLOKHSA-N |
| XLogP | 2.43 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|