C14H10N2O5 — CID 91337367
3-[(2-cyano-3-oxobutanoyl)amino]-1-benzofuran-2-carboxylic acid (PubChem CID 91337367) has the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. Its IUPAC name is 3-[(2-cyano-3-oxobutanoyl)amino]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[(2-cyano-3-oxobutanoyl)amino]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 91337367 |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-[(2-cyano-3-oxobutanoyl)amino]-1-benzofuran-2-carboxylic acid |
| SMILES | CC(=O)C(C#N)C(=O)Nc1c(C(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C14H10N2O5/c1-7(17)9(6-15)13(18)16-11-8-4-2-3-5-10(8)21-12(11)14(19)20/h2-5,9H,1H3,(H,16,18)(H,19,20) |
| InChIKey | CGGSPOLYTNEMHG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 120.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|