C18H14FN3O5 — CID 9275304
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-cyanophenoxy)acetate (PubChem CID 9275304) has the molecular formula C18H14FN3O5 and a molecular weight of 371.32 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-cyanophenoxy)acetate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9275304 |
| Molecular Formula | C18H14FN3O5 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-cyanophenoxy)acetate |
| SMILES | N#Cc1ccccc1OCC(=O)OCC(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H14FN3O5/c19-14-7-3-2-6-13(14)18(25)22-21-16(23)10-27-17(24)11-26-15-8-4-1-5-12(15)9-20/h1-8H,10-11H2,(H,21,23)(H,22,25) |
| InChIKey | GFCVOHMUMFSBJA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|