C18H13F3N2O4 — CID 2124208
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(2-cyanophenoxy)acetate (PubChem CID 2124208) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(2-cyanophenoxy)acetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 2124208 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-(2-cyanophenoxy)acetate |
| SMILES | N#Cc1ccccc1OCC(=O)OCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13F3N2O4/c19-18(20,21)13-5-7-14(8-6-13)23-16(24)10-27-17(25)11-26-15-4-2-1-3-12(15)9-22/h1-8H,10-11H2,(H,23,24) |
| InChIKey | NVOCRPWFHABBEX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |