C17H17N3O4 — CID 9318201
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(2-cyanophenoxy)acetate (PubChem CID 9318201) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(2-cyanophenoxy)acetate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9318201 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(2-cyanophenoxy)acetate |
| SMILES | N#Cc1ccccc1OCC(=O)OCC(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C17H17N3O4/c18-9-13-5-1-2-6-14(13)23-11-16(22)24-10-15(21)20-17(12-19)7-3-4-8-17/h1-2,5-6H,3-4,7-8,10-11H2,(H,20,21) |
| InChIKey | MDIYPXUBOWDQIF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |