C19H23N3O5 — CID 7827716
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-[(2-methoxybenzoyl)amino]propanoate (PubChem CID 7827716) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-[(2-methoxybenzoyl)amino]propanoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-[(2-methoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827716 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-[(2-methoxybenzoyl)amino]propanoate |
| SMILES | COc1ccccc1C(=O)NCCC(=O)OCC(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C19H23N3O5/c1-26-15-7-3-2-6-14(15)18(25)21-11-8-17(24)27-12-16(23)22-19(13-20)9-4-5-10-19/h2-3,6-7H,4-5,8-12H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | GFLWIVXFBULZJJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |