C18H23N3O5S — CID 7912998
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-(benzenesulfonamido)propanoate (PubChem CID 7912998) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-(benzenesulfonamido)propanoate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 7912998 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-(benzenesulfonamido)propanoate |
| SMILES | N#CC1(NC(=O)COC(=O)CCNS(=O)(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H23N3O5S/c19-14-18(10-5-2-6-11-18)21-16(22)13-26-17(23)9-12-20-27(24,25)15-7-3-1-4-8-15/h1,3-4,7-8,20H,2,5-6,9-13H2,(H,21,22) |
| InChIKey | XFOSASANBSPQMO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |