C20H25N3O5S — CID 42981676
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 42981676) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 42981676 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | N#CC1(NC(=O)COC(=O)C2CCCCN2S(=O)(=O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H25N3O5S/c21-15-20(11-5-6-12-20)22-18(24)14-28-19(25)17-10-4-7-13-23(17)29(26,27)16-8-2-1-3-9-16/h1-3,8-9,17H,4-7,10-14H2,(H,22,24) |
| InChIKey | BBZNALUKDFNCJQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |