C20H28N2O5S — CID 7617627
[2-(cyclopentylamino)-2-oxoethyl] (2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 7617627) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] (2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] (2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 7617627 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] (2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2C(=O)OCC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C20H28N2O5S/c1-15-9-11-17(12-10-15)28(25,26)22-13-5-4-8-18(22)20(24)27-14-19(23)21-16-6-2-3-7-16/h9-12,16,18H,2-8,13-14H2,1H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | FULSEPCVQXUNGL-GOSISDBHSA-N |
| XLogP | 2.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |