C19H23N3O5S — CID 16616657
[(E)-4-amino-3-cyano-2-oxopent-3-enyl] 1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 16616657) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 16616657 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | C/C(N)=C(/C#N)C(=O)COC(=O)C1CCCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-13-6-8-15(9-7-13)28(25,26)22-10-4-3-5-17(22)19(24)27-12-18(23)16(11-20)14(2)21/h6-9,17H,3-5,10,12,21H2,1-2H3/b16-14+ |
| InChIKey | GOMXCTKIEDBQEC-JQIJEIRASA-N |
| XLogP | 1.41 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|