C21H22N2O6S — CID 42973160
(2-benzamido-2-oxoethyl) 1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 42973160) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | (2-benzamido-2-oxoethyl) 1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 42973160 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | O=C(COC(=O)C1CCCCN1S(=O)(=O)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O6S/c24-19(22-20(25)16-9-3-1-4-10-16)15-29-21(26)18-13-7-8-14-23(18)30(27,28)17-11-5-2-6-12-17/h1-6,9-12,18H,7-8,13-15H2,(H,22,24,25) |
| InChIKey | CHAABQJMBGVEQL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |