C21H22BrNO6S — CID 42983209
[2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 42983209) has the molecular formula C21H22BrNO6S and a molecular weight of 496.38 g/mol. Its IUPAC name is [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 42983209 |
| Molecular Formula | C21H22BrNO6S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | [2-(3-bromo-4-methoxyphenyl)-2-oxoethyl] 1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)C2CCCCN2S(=O)(=O)c2ccccc2)cc1Br |
| InChI | InChI=1S/C21H22BrNO6S/c1-28-20-11-10-15(13-17(20)22)19(24)14-29-21(25)18-9-5-6-12-23(18)30(26,27)16-7-3-2-4-8-16/h2-4,7-8,10-11,13,18H,5-6,9,12,14H2,1H3 |
| InChIKey | JWALTESVPGHNQH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |