C18H21N3O5S — CID 8853323
(3-cyano-4-imino-2-oxopentyl) (2S)-1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 8853323) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) (2S)-1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) (2S)-1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 8853323 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) (2S)-1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)[C@@H]1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-13(20)15(11-19)17(22)12-26-18(23)16-9-5-6-10-21(16)27(24,25)14-7-3-2-4-8-14/h2-4,7-8,15-16,20H,5-6,9-10,12H2,1H3/b20-13+/t15?,16-/m0/s1 |
| InChIKey | HBJCEHWWCSGJAO-DZGIPBBSSA-N |
| XLogP | 1.52 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|