C24H20N4O5S — CID 3255620
[3-(dicyanomethylidene)-2-oxoindol-1-yl]methyl 1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 3255620) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is [3-(dicyanomethylidene)-2-oxoindol-1-yl]methyl 1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | [3-(dicyanomethylidene)-2-oxoindol-1-yl]methyl 1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 3255620 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [3-(dicyanomethylidene)-2-oxoindol-1-yl]methyl 1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | N#CC(C#N)=C1C(=O)N(COC(=O)C2CCCCN2S(=O)(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H20N4O5S/c25-14-17(15-26)22-19-10-4-5-11-20(19)27(23(22)29)16-33-24(30)21-12-6-7-13-28(21)34(31,32)18-8-2-1-3-9-18/h1-5,8-11,21H,6-7,12-13,16H2 |
| InChIKey | HYXFZPRAALRYSO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 131.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|