C24H19FN4O5S — CID 3263681
[3-(dicyanomethylidene)-2-oxoindol-1-yl]methyl 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 3263681) has the molecular formula C24H19FN4O5S and a molecular weight of 494.50 g/mol. Its IUPAC name is [3-(dicyanomethylidene)-2-oxoindol-1-yl]methyl 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [3-(dicyanomethylidene)-2-oxoindol-1-yl]methyl 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 3263681 |
| Molecular Formula | C24H19FN4O5S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | [3-(dicyanomethylidene)-2-oxoindol-1-yl]methyl 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | N#CC(C#N)=C1C(=O)N(COC(=O)C2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H19FN4O5S/c25-18-5-7-19(8-6-18)35(32,33)28-11-9-16(10-12-28)24(31)34-15-29-21-4-2-1-3-20(21)22(23(29)30)17(13-26)14-27/h1-8,16H,9-12,15H2 |
| InChIKey | CXTHDYGEDKMWES-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 131.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|