C19H18N2O4S — CID 3695394
benzyl 1-(3-cyanophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 3695394) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is benzyl 1-(3-cyanophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-(3-cyanophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3695394 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | benzyl 1-(3-cyanophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CCCC2C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H18N2O4S/c20-13-16-8-4-9-17(12-16)26(23,24)21-11-5-10-18(21)19(22)25-14-15-6-2-1-3-7-15/h1-4,6-9,12,18H,5,10-11,14H2 |
| InChIKey | LUOUPVQRECGADA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |