C22H22N2O4 — CID 6733946
2-O-benzyl 1-O-[2-(4-cyanophenyl)ethyl] pyrrolidine-1,2-dicarboxylate (PubChem CID 6733946) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-O-benzyl 1-O-[2-(4-cyanophenyl)ethyl] pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-[2-(4-cyanophenyl)ethyl] pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6733946 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-O-benzyl 1-O-[2-(4-cyanophenyl)ethyl] pyrrolidine-1,2-dicarboxylate |
| SMILES | N#Cc1ccc(CCOC(=O)N2CCCC2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O4/c23-15-18-10-8-17(9-11-18)12-14-27-22(26)24-13-4-7-20(24)21(25)28-16-19-5-2-1-3-6-19/h1-3,5-6,8-11,20H,4,7,12-14,16H2 |
| InChIKey | JQJZFLFXLLYEJG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |