C15H17N3O4 — CID 145362151
1-O-[(4-aminophenyl)methyl] 2-O-(cyanomethyl) pyrrolidine-1,2-dicarboxylate (PubChem CID 145362151) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1-O-[(4-aminophenyl)methyl] 2-O-(cyanomethyl) pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-[(4-aminophenyl)methyl] 2-O-(cyanomethyl) pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 145362151 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-O-[(4-aminophenyl)methyl] 2-O-(cyanomethyl) pyrrolidine-1,2-dicarboxylate |
| SMILES | N#CCOC(=O)C1CCCN1C(=O)OCc1ccc(N)cc1 |
| InChI | InChI=1S/C15H17N3O4/c16-7-9-21-14(19)13-2-1-8-18(13)15(20)22-10-11-3-5-12(17)6-4-11/h3-6,13H,1-2,8-10,17H2 |
| InChIKey | PFJJBGZXFMVGIW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|