C16H19N3O5S — CID 143106546
ethyl 2-[[1-(3-cyanophenyl)sulfonylpyrrolidine-2-carbonyl]amino]acetate (PubChem CID 143106546) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is ethyl 2-[[1-(3-cyanophenyl)sulfonylpyrrolidine-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[1-(3-cyanophenyl)sulfonylpyrrolidine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 143106546 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | ethyl 2-[[1-(3-cyanophenyl)sulfonylpyrrolidine-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1CCCN1S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H19N3O5S/c1-2-24-15(20)11-18-16(21)14-7-4-8-19(14)25(22,23)13-6-3-5-12(9-13)10-17/h3,5-6,9,14H,2,4,7-8,11H2,1H3,(H,18,21) |
| InChIKey | LWFPRBZTJMPBCR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |