C17H20N2O3S — CID 6460526
N-ethyl-1-naphthalen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 6460526) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is N-ethyl-1-naphthalen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-ethyl-1-naphthalen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6460526 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-ethyl-1-naphthalen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)C1CCCN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H20N2O3S/c1-2-18-17(20)16-8-5-11-19(16)23(21,22)15-10-9-13-6-3-4-7-14(13)12-15/h3-4,6-7,9-10,12,16H,2,5,8,11H2,1H3,(H,18,20) |
| InChIKey | NZGRXZLRVINMCY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |