C23H22Cl2N2O4S — CID 41248997
(2R)-N-[2-(2,3-dichlorophenoxy)ethyl]-1-naphthalen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 41248997) has the molecular formula C23H22Cl2N2O4S and a molecular weight of 493.41 g/mol. Its IUPAC name is (2R)-N-[2-(2,3-dichlorophenoxy)ethyl]-1-naphthalen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-(2,3-dichlorophenoxy)ethyl]-1-naphthalen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 41248997 |
| Molecular Formula | C23H22Cl2N2O4S |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | (2R)-N-[2-(2,3-dichlorophenoxy)ethyl]-1-naphthalen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCCOc1cccc(Cl)c1Cl)[C@H]1CCCN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H22Cl2N2O4S/c24-19-7-3-9-21(22(19)25)31-14-12-26-23(28)20-8-4-13-27(20)32(29,30)18-11-10-16-5-1-2-6-17(16)15-18/h1-3,5-7,9-11,15,20H,4,8,12-14H2,(H,26,28)/t20-/m1/s1 |
| InChIKey | WOJAHURISVUZBO-HXUWFJFHSA-N |
| XLogP | 4.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|