C26H30N2O4S — CID 3497150
1-naphthalen-2-ylsulfonyl-N-[2-(4-propan-2-ylphenoxy)ethyl]pyrrolidine-2-carboxamide (PubChem CID 3497150) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is 1-naphthalen-2-ylsulfonyl-N-[2-(4-propan-2-ylphenoxy)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-naphthalen-2-ylsulfonyl-N-[2-(4-propan-2-ylphenoxy)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3497150 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1-naphthalen-2-ylsulfonyl-N-[2-(4-propan-2-ylphenoxy)ethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)c1ccc(OCCNC(=O)C2CCCN2S(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C26H30N2O4S/c1-19(2)20-9-12-23(13-10-20)32-17-15-27-26(29)25-8-5-16-28(25)33(30,31)24-14-11-21-6-3-4-7-22(21)18-24/h3-4,6-7,9-14,18-19,25H,5,8,15-17H2,1-2H3,(H,27,29) |
| InChIKey | YTVNBTGSXKTHPB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|