C25H22FN3O3S — CID 75298525
N-[[3-(4-cyanophenyl)phenyl]methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 75298525) has the molecular formula C25H22FN3O3S and a molecular weight of 463.53 g/mol. Its IUPAC name is N-[[3-(4-cyanophenyl)phenyl]methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[[3-(4-cyanophenyl)phenyl]methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 75298525 |
| Molecular Formula | C25H22FN3O3S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-[[3-(4-cyanophenyl)phenyl]methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | N#Cc1ccc(-c2cccc(CNC(=O)C3CCCN3S(=O)(=O)c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C25H22FN3O3S/c26-22-10-12-23(13-11-22)33(31,32)29-14-2-5-24(29)25(30)28-17-19-3-1-4-21(15-19)20-8-6-18(16-27)7-9-20/h1,3-4,6-13,15,24H,2,5,14,17H2,(H,28,30) |
| InChIKey | METLPQKYEWARGA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |