C21H23FN2O3S — CID 70941491
N-[(3-cyclopropylphenyl)methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 70941491) has the molecular formula C21H23FN2O3S and a molecular weight of 402.49 g/mol. Its IUPAC name is N-[(3-cyclopropylphenyl)methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[(3-cyclopropylphenyl)methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70941491 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[(3-cyclopropylphenyl)methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1cccc(C2CC2)c1)C1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O3S/c22-18-8-10-19(11-9-18)28(26,27)24-12-2-5-20(24)21(25)23-14-15-3-1-4-17(13-15)16-6-7-16/h1,3-4,8-11,13,16,20H,2,5-7,12,14H2,(H,23,25) |
| InChIKey | JYGKHJJVPPQZOM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |