C19H24N2O4 — CID 8524295
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate (PubChem CID 8524295) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 8524295 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CCC(=O)OCC(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C19H24N2O4/c1-24-16-8-4-3-7-15(16)9-10-18(23)25-13-17(22)21-19(14-20)11-5-2-6-12-19/h3-4,7-8H,2,5-6,9-13H2,1H3,(H,21,22) |
| InChIKey | HVQSWKRQZMASJR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |