C16H18N2O4 — CID 7834274
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate (PubChem CID 7834274) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 7834274 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate |
| SMILES | N#CC1(NC(=O)COC(=O)[C@@H](O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C16H18N2O4/c17-11-16(8-4-5-9-16)18-13(19)10-22-15(21)14(20)12-6-2-1-3-7-12/h1-3,6-7,14,20H,4-5,8-10H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | JZSCXYBAICIWPB-AWEZNQCLSA-N |
| XLogP | 1.22 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |