C21H23N3O — CID 7516068
2-(benzhydrylamino)-N-(1-cyanocyclopentyl)acetamide (PubChem CID 7516068) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-(benzhydrylamino)-N-(1-cyanocyclopentyl)acetamide.
| Compound Name | 2-(benzhydrylamino)-N-(1-cyanocyclopentyl)acetamide |
|---|---|
| PubChem CID | 7516068 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-(benzhydrylamino)-N-(1-cyanocyclopentyl)acetamide |
| SMILES | N#CC1(NC(=O)CNC(c2ccccc2)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H23N3O/c22-16-21(13-7-8-14-21)24-19(25)15-23-20(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,20,23H,7-8,13-15H2,(H,24,25) |
| InChIKey | ZEFVUMXOESYUNI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |