C22H22N2O3S — CID 8821271
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 8821271) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 8821271 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2S)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | N#CC1(NC(=O)COC(=O)[C@@H](Sc2ccccc2)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C22H22N2O3S/c23-16-22(13-7-8-14-22)24-19(25)15-27-21(26)20(17-9-3-1-4-10-17)28-18-11-5-2-6-12-18/h1-6,9-12,20H,7-8,13-15H2,(H,24,25)/t20-/m0/s1 |
| InChIKey | BBNZAIYTWMPSQY-FQEVSTJZSA-N |
| XLogP | 4.02 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |