C19H23N3O4 — CID 7132991
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (3R)-3-acetamido-3-phenylpropanoate (PubChem CID 7132991) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (3R)-3-acetamido-3-phenylpropanoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (3R)-3-acetamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 7132991 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (3R)-3-acetamido-3-phenylpropanoate |
| SMILES | CC(=O)N[C@H](CC(=O)OCC(=O)NC1(C#N)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O4/c1-14(23)21-16(15-7-3-2-4-8-15)11-18(25)26-12-17(24)22-19(13-20)9-5-6-10-19/h2-4,7-8,16H,5-6,9-12H2,1H3,(H,21,23)(H,22,24)/t16-/m1/s1 |
| InChIKey | RYABWIALLRJBRM-MRXNPFEDSA-N |
| XLogP | 1.75 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |