C17H19ClN2O3S — CID 7821280
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2R)-2-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 7821280) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2R)-2-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2R)-2-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7821280 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (2R)-2-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | C[C@@H](Sc1ccc(Cl)cc1)C(=O)OCC(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C17H19ClN2O3S/c1-12(24-14-6-4-13(18)5-7-14)16(22)23-10-15(21)20-17(11-19)8-2-3-9-17/h4-7,12H,2-3,8-10H2,1H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | ZPBXRXXFWALQTO-GFCCVEGCSA-N |
| XLogP | 3.32 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |