C21H22N2O — CID 78830716
N-(1-cyanocyclohexyl)-2,2-diphenylacetamide (PubChem CID 78830716) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2,2-diphenylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 78830716 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2,2-diphenylacetamide |
| SMILES | N#CC1(NC(=O)C(c2ccccc2)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H22N2O/c22-16-21(14-8-3-9-15-21)23-20(24)19(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-2,4-7,10-13,19H,3,8-9,14-15H2,(H,23,24) |
| InChIKey | GFUFQAMELJJTFG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |