About N-(1-cyanocycloheptyl)-2,2-difluoroacetamide
N-(1-cyanocycloheptyl)-2,2-difluoroacetamide (PubChem CID 103513731) has the molecular formula C10H14F2N2O
and a molecular weight of 216.23 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-(1-cyanocycloheptyl)-2,2-difluoroacetamide |
| PubChem CID | 103513731 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2,2-difluoroacetamide |
| SMILES | N#CC1(NC(=O)C(F)F)CCCCCC1 |
| InChI | InChI=1S/C10H14F2N2O/c11-8(12)9(15)14-10(7-13)5-3-1-2-4-6-10/h8H,1-6H2,(H,14,15) |
| InChIKey | UJVIRQWHJQOVAD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyanocycloheptyl)-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanocycloheptyl)-2,2-difluoroacetamide?
The IUPAC name of N-(1-cyanocycloheptyl)-2,2-difluoroacetamide (CID 103513731) is N-(1-cyanocycloheptyl)-2,2-difluoroacetamide.
What is the SMILES notation for N-(1-cyanocycloheptyl)-2,2-difluoroacetamide?
The canonical SMILES for N-(1-cyanocycloheptyl)-2,2-difluoroacetamide is N#CC1(NC(=O)C(F)F)CCCCCC1.
What is the InChIKey of N-(1-cyanocycloheptyl)-2,2-difluoroacetamide?
The InChIKey is UJVIRQWHJQOVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O/c11-8(12)9(15)14-10(7-13)5-3-1-2-4-6-10/h8H,1-6H2,(H,14,15).
What are the key properties of N-(1-cyanocycloheptyl)-2,2-difluoroacetamide?
N-(1-cyanocycloheptyl)-2,2-difluoroacetamide has a molecular weight of 216.23 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanocycloheptyl)-2,2-difluoroacetamide is sourced from PubChem (CID 103513731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).