C10H14F2N2O — CID 103513731
N-(1-cyanocycloheptyl)-2,2-difluoroacetamide (PubChem CID 103513731) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2,2-difluoroacetamide.
| Compound Name | N-(1-cyanocycloheptyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103513731 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2,2-difluoroacetamide |
| SMILES | N#CC1(NC(=O)C(F)F)CCCCCC1 |
| InChI | InChI=1S/C10H14F2N2O/c11-8(12)9(15)14-10(7-13)5-3-1-2-4-6-10/h8H,1-6H2,(H,14,15) |
| InChIKey | UJVIRQWHJQOVAD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |