C16H18N2O3 — CID 7434176
2-(2-acetylphenoxy)-N-(1-cyanocyclopentyl)acetamide (PubChem CID 7434176) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(2-acetylphenoxy)-N-(1-cyanocyclopentyl)acetamide.
| Compound Name | 2-(2-acetylphenoxy)-N-(1-cyanocyclopentyl)acetamide |
|---|---|
| PubChem CID | 7434176 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-(2-acetylphenoxy)-N-(1-cyanocyclopentyl)acetamide |
| SMILES | CC(=O)c1ccccc1OCC(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C16H18N2O3/c1-12(19)13-6-2-3-7-14(13)21-10-15(20)18-16(11-17)8-4-5-9-16/h2-3,6-7H,4-5,8-10H2,1H3,(H,18,20) |
| InChIKey | SHGNYPQOZQHDSZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |