C21H20ClN3O3 — CID 24578741
5-chloro-2-[2-[(1-cyanocyclopentyl)amino]-2-oxoethoxy]-N-phenylbenzamide (PubChem CID 24578741) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is 5-chloro-2-[2-[(1-cyanocyclopentyl)amino]-2-oxoethoxy]-N-phenylbenzamide.
| Compound Name | 5-chloro-2-[2-[(1-cyanocyclopentyl)amino]-2-oxoethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 24578741 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 5-chloro-2-[2-[(1-cyanocyclopentyl)amino]-2-oxoethoxy]-N-phenylbenzamide |
| SMILES | N#CC1(NC(=O)COc2ccc(Cl)cc2C(=O)Nc2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H20ClN3O3/c22-15-8-9-18(17(12-15)20(27)24-16-6-2-1-3-7-16)28-13-19(26)25-21(14-23)10-4-5-11-21/h1-3,6-9,12H,4-5,10-11,13H2,(H,24,27)(H,25,26) |
| InChIKey | IRSACLWVSUXTOK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |