C25H22ClN3O3 — CID 24578794
5-chloro-2-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethoxy]-N-phenylbenzamide (PubChem CID 24578794) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is 5-chloro-2-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethoxy]-N-phenylbenzamide.
| Compound Name | 5-chloro-2-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 24578794 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 5-chloro-2-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethoxy]-N-phenylbenzamide |
| SMILES | O=C(COc1ccc(Cl)cc1C(=O)Nc1ccccc1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H22ClN3O3/c26-18-10-11-23(21(14-18)25(31)29-19-6-2-1-3-7-19)32-16-24(30)27-13-12-17-15-28-22-9-5-4-8-20(17)22/h1-11,14-15,28H,12-13,16H2,(H,27,30)(H,29,31) |
| InChIKey | MBNXUBWUCMZJNG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |