C18H15Cl2N3O3 — CID 24563218
N'-[2-(2,5-dichlorophenoxy)acetyl]-2-(1H-indol-3-yl)acetohydrazide (PubChem CID 24563218) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is N'-[2-(2,5-dichlorophenoxy)acetyl]-2-(1H-indol-3-yl)acetohydrazide.
| Compound Name | N'-[2-(2,5-dichlorophenoxy)acetyl]-2-(1H-indol-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 24563218 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N'-[2-(2,5-dichlorophenoxy)acetyl]-2-(1H-indol-3-yl)acetohydrazide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H15Cl2N3O3/c19-12-5-6-14(20)16(8-12)26-10-18(25)23-22-17(24)7-11-9-21-15-4-2-1-3-13(11)15/h1-6,8-9,21H,7,10H2,(H,22,24)(H,23,25) |
| InChIKey | VSTKAAGDWHRBJS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|