C18H13Cl2NO2 — CID 19167989
2-(2,5-dichlorophenoxy)-N-naphthalen-1-ylacetamide (PubChem CID 19167989) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-naphthalen-1-ylacetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 19167989 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-naphthalen-1-ylacetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C18H13Cl2NO2/c19-13-8-9-15(20)17(10-13)23-11-18(22)21-16-7-3-5-12-4-1-2-6-14(12)16/h1-10H,11H2,(H,21,22) |
| InChIKey | FROCLSQEDHYEHA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |