C14H9Cl2N3O2S — CID 4857109
N-(2,1,3-benzothiadiazol-4-yl)-2-(2,5-dichlorophenoxy)acetamide (PubChem CID 4857109) has the molecular formula C14H9Cl2N3O2S and a molecular weight of 354.22 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-2-(2,5-dichlorophenoxy)acetamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-2-(2,5-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 4857109 |
| Molecular Formula | C14H9Cl2N3O2S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-2-(2,5-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C14H9Cl2N3O2S/c15-8-4-5-9(16)12(6-8)21-7-13(20)17-10-2-1-3-11-14(10)19-22-18-11/h1-6H,7H2,(H,17,20) |
| InChIKey | YBLSPUHASMWKSK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |