C14H12N4O2S — CID 61027525
2-(4-aminophenoxy)-N-(2,1,3-benzothiadiazol-4-yl)acetamide (PubChem CID 61027525) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-(4-aminophenoxy)-N-(2,1,3-benzothiadiazol-4-yl)acetamide.
| Compound Name | 2-(4-aminophenoxy)-N-(2,1,3-benzothiadiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 61027525 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(4-aminophenoxy)-N-(2,1,3-benzothiadiazol-4-yl)acetamide |
| SMILES | Nc1ccc(OCC(=O)Nc2cccc3nsnc23)cc1 |
| InChI | InChI=1S/C14H12N4O2S/c15-9-4-6-10(7-5-9)20-8-13(19)16-11-2-1-3-12-14(11)18-21-17-12/h1-7H,8,15H2,(H,16,19) |
| InChIKey | OWXDYUWWMSTQPL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|