C21H14N4O2S — CID 7670832
N-(2,1,3-benzothiadiazol-4-yl)-2-[4-(4-cyanophenyl)phenoxy]acetamide (PubChem CID 7670832) has the molecular formula C21H14N4O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-2-[4-(4-cyanophenyl)phenoxy]acetamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-2-[4-(4-cyanophenyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 7670832 |
| Molecular Formula | C21H14N4O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-2-[4-(4-cyanophenyl)phenoxy]acetamide |
| SMILES | N#Cc1ccc(-c2ccc(OCC(=O)Nc3cccc4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C21H14N4O2S/c22-12-14-4-6-15(7-5-14)16-8-10-17(11-9-16)27-13-20(26)23-18-2-1-3-19-21(18)25-28-24-19/h1-11H,13H2,(H,23,26) |
| InChIKey | RWMFPWALIARDMW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |