C16H12N4O6S — CID 16512082
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-(4-nitrophenoxy)acetate (PubChem CID 16512082) has the molecular formula C16H12N4O6S and a molecular weight of 388.36 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-(4-nitrophenoxy)acetate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-(4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 16512082 |
| Molecular Formula | C16H12N4O6S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-(4-nitrophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccc([N+](=O)[O-])cc1)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C16H12N4O6S/c21-14(17-12-2-1-3-13-16(12)19-27-18-13)8-26-15(22)9-25-11-6-4-10(5-7-11)20(23)24/h1-7H,8-9H2,(H,17,21) |
| InChIKey | PMOQKMKUHZDTFN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|