C18H17N3O3S — CID 7227914
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (3S)-3-phenylbutanoate (PubChem CID 7227914) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (3S)-3-phenylbutanoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (3S)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7227914 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] (3S)-3-phenylbutanoate |
| SMILES | C[C@@H](CC(=O)OCC(=O)Nc1cccc2nsnc12)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O3S/c1-12(13-6-3-2-4-7-13)10-17(23)24-11-16(22)19-14-8-5-9-15-18(14)21-25-20-15/h2-9,12H,10-11H2,1H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | KQVYPTNBEYDRLS-LBPRGKRZSA-N |
| XLogP | 3.37 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |