C22H15N3O4S — CID 16539755
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 16539755) has the molecular formula C22H15N3O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 16539755 |
| Molecular Formula | C22H15N3O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)c1ccccc1)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C22H15N3O4S/c26-19(23-17-11-6-12-18-20(17)25-30-24-18)13-29-22(28)16-10-5-4-9-15(16)21(27)14-7-2-1-3-8-14/h1-12H,13H2,(H,23,26) |
| InChIKey | RQHROXSQNUSBOA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |