C16H14Cl3NO4 — CID 24685752
N-(2-chloro-4,5-dimethoxyphenyl)-2-(2,5-dichlorophenoxy)acetamide (PubChem CID 24685752) has the molecular formula C16H14Cl3NO4 and a molecular weight of 390.65 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-2-(2,5-dichlorophenoxy)acetamide.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-(2,5-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 24685752 |
| Molecular Formula | C16H14Cl3NO4 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-(2,5-dichlorophenoxy)acetamide |
| SMILES | COc1cc(Cl)c(NC(=O)COc2cc(Cl)ccc2Cl)cc1OC |
| InChI | InChI=1S/C16H14Cl3NO4/c1-22-14-6-11(19)12(7-15(14)23-2)20-16(21)8-24-13-5-9(17)3-4-10(13)18/h3-7H,8H2,1-2H3,(H,20,21) |
| InChIKey | NBBRXMNCYTYVJL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |