C14H8BrF3O2 — CID 60626920
2-(4-bromo-2-fluorophenoxy)-1-(2,5-difluorophenyl)ethanone (PubChem CID 60626920) has the molecular formula C14H8BrF3O2 and a molecular weight of 345.11 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-1-(2,5-difluorophenyl)ethanone.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-1-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 60626920 |
| Molecular Formula | C14H8BrF3O2 |
| Molecular Weight | 345.11 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-1-(2,5-difluorophenyl)ethanone |
| SMILES | O=C(COc1ccc(Br)cc1F)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H8BrF3O2/c15-8-1-4-14(12(18)5-8)20-7-13(19)10-6-9(16)2-3-11(10)17/h1-6H,7H2 |
| InChIKey | CAMNEHBBLSFEAV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.11 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |