C14H8BrCl2IO2 — CID 166094938
2-(3-bromo-2-iodophenoxy)-1-(2,4-dichlorophenyl)ethanone (PubChem CID 166094938) has the molecular formula C14H8BrCl2IO2 and a molecular weight of 485.93 g/mol. Its IUPAC name is 2-(3-bromo-2-iodophenoxy)-1-(2,4-dichlorophenyl)ethanone.
| Compound Name | 2-(3-bromo-2-iodophenoxy)-1-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 166094938 |
| Molecular Formula | C14H8BrCl2IO2 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 483.81 |
| IUPAC Name | 2-(3-bromo-2-iodophenoxy)-1-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(COc1cccc(Br)c1I)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8BrCl2IO2/c15-10-2-1-3-13(14(10)18)20-7-12(19)9-5-4-8(16)6-11(9)17/h1-6H,7H2 |
| InChIKey | KWEKOKGHBGBMRX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|