C10H10Cl2OS — CID 103073637
2-[(2,4-dichlorophenoxy)methyl]prop-2-ene-1-thiol (PubChem CID 103073637) has the molecular formula C10H10Cl2OS and a molecular weight of 249.16 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenoxy)methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[(2,4-dichlorophenoxy)methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073637 |
| Molecular Formula | C10H10Cl2OS |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 2-[(2,4-dichlorophenoxy)methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2OS/c1-7(6-14)5-13-10-3-2-8(11)4-9(10)12/h2-4,14H,1,5-6H2 |
| InChIKey | DURTWHIFAYRRNM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|