C11H16Cl2NO2+ — CID 7460356
3-(2,5-dichlorophenoxy)propyl-(2-hydroxyethyl)azanium (PubChem CID 7460356) has the molecular formula C11H16Cl2NO2+ and a molecular weight of 265.16 g/mol. Its IUPAC name is 3-(2,5-dichlorophenoxy)propyl-(2-hydroxyethyl)azanium.
| Compound Name | 3-(2,5-dichlorophenoxy)propyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 7460356 |
| Molecular Formula | C11H16Cl2NO2+ |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-(2,5-dichlorophenoxy)propyl-(2-hydroxyethyl)azanium |
| SMILES | OCC[NH2+]CCCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2NO2/c12-9-2-3-10(13)11(8-9)16-7-1-4-14-5-6-15/h2-3,8,14-15H,1,4-7H2/p+1 |
| InChIKey | PKNBUHQTHMWAAT-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|